C15H10O5 — CID 171936163
9-hydroxy-8-methyl-[1,3]benzodioxolo[6,7-c]chromen-6-one (PubChem CID 171936163) has the molecular formula C15H10O5 and a molecular weight of 270.24 g/mol. Its IUPAC name is 9-hydroxy-8-methyl-[1,3]benzodioxolo[6,7-c]chromen-6-one.
| Compound Name | 9-hydroxy-8-methyl-[1,3]benzodioxolo[6,7-c]chromen-6-one |
|---|---|
| PubChem CID | 171936163 |
| Molecular Formula | C15H10O5 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 9-hydroxy-8-methyl-[1,3]benzodioxolo[6,7-c]chromen-6-one |
| SMILES | Cc1c(O)ccc2c1oc(=O)c1ccc3c(c12)OCO3 |
| InChI | InChI=1S/C15H10O5/c1-7-10(16)4-2-8-12-9(15(17)20-13(7)8)3-5-11-14(12)19-6-18-11/h2-5,16H,6H2,1H3 |
| InChIKey | BRGUMBONFMIQPC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|