C13H11ClO5 — CID 11087264
9-chloro-3-hydroxy-8-methyl-3,4-dihydro-2H-pyrano[3,2-i][1,5]benzodioxepin-10-one (PubChem CID 11087264) has the molecular formula C13H11ClO5 and a molecular weight of 282.68 g/mol. Its IUPAC name is 9-chloro-3-hydroxy-8-methyl-3,4-dihydro-2H-pyrano[3,2-i][1,5]benzodioxepin-10-one.
| Compound Name | 9-chloro-3-hydroxy-8-methyl-3,4-dihydro-2H-pyrano[3,2-i][1,5]benzodioxepin-10-one |
|---|---|
| PubChem CID | 11087264 |
| Molecular Formula | C13H11ClO5 |
| Molecular Weight | 282.68 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 9-chloro-3-hydroxy-8-methyl-3,4-dihydro-2H-pyrano[3,2-i][1,5]benzodioxepin-10-one |
| SMILES | Cc1c(Cl)c(=O)oc2c3c(ccc12)OCC(O)CO3 |
| InChI | InChI=1S/C13H11ClO5/c1-6-8-2-3-9-12(18-5-7(15)4-17-9)11(8)19-13(16)10(6)14/h2-3,7,15H,4-5H2,1H3 |
| InChIKey | BRVFHIPTKWEQCR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.68 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|