C19H27ClNO5PS — CID 134117573
3-chloro-7-diethoxyphosphinothioyloxy-8-(diethylaminomethyl)-4-methylchromen-2-one (PubChem CID 134117573) has the molecular formula C19H27ClNO5PS and a molecular weight of 447.92 g/mol. Its IUPAC name is 3-chloro-7-diethoxyphosphinothioyloxy-8-(diethylaminomethyl)-4-methylchromen-2-one.
| Compound Name | 3-chloro-7-diethoxyphosphinothioyloxy-8-(diethylaminomethyl)-4-methylchromen-2-one |
|---|---|
| PubChem CID | 134117573 |
| Molecular Formula | C19H27ClNO5PS |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 3-chloro-7-diethoxyphosphinothioyloxy-8-(diethylaminomethyl)-4-methylchromen-2-one |
| SMILES | CCOP(=S)(OCC)Oc1ccc2c(C)c(Cl)c(=O)oc2c1CN(CC)CC |
| InChI | InChI=1S/C19H27ClNO5PS/c1-6-21(7-2)12-15-16(26-27(28,23-8-3)24-9-4)11-10-14-13(5)17(20)19(22)25-18(14)15/h10-11H,6-9,12H2,1-5H3 |
| InChIKey | BVSYZMRVFFAGCI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|