C17H21O5PS — CID 11307
3-diethoxyphosphinothioyloxy-7,8,9,10-tetrahydrobenzo[c]chromen-6-one (PubChem CID 11307) has the molecular formula C17H21O5PS and a molecular weight of 368.39 g/mol. Its IUPAC name is 3-diethoxyphosphinothioyloxy-7,8,9,10-tetrahydrobenzo[c]chromen-6-one.
| Compound Name | 3-diethoxyphosphinothioyloxy-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 11307 |
| Molecular Formula | C17H21O5PS |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 3-diethoxyphosphinothioyloxy-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
| SMILES | CCOP(=S)(OCC)Oc1ccc2c3c(c(=O)oc2c1)CCCC3 |
| InChI | InChI=1S/C17H21O5PS/c1-3-19-23(24,20-4-2)22-12-9-10-14-13-7-5-6-8-15(13)17(18)21-16(14)11-12/h9-11H,3-8H2,1-2H3 |
| InChIKey | NSMRHYDOKZAMKJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|