C18H20O5 — CID 4187099
ethyl 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]butanoate (PubChem CID 4187099) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is ethyl 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]butanoate.
| Compound Name | ethyl 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]butanoate |
|---|---|
| PubChem CID | 4187099 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | ethyl 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]butanoate |
| SMILES | CCOC(=O)C(CC)Oc1ccc2c3c(c(=O)oc2c1)CCC3 |
| InChI | InChI=1S/C18H20O5/c1-3-15(18(20)21-4-2)22-11-8-9-13-12-6-5-7-14(12)17(19)23-16(13)10-11/h8-10,15H,3-7H2,1-2H3 |
| InChIKey | GKTZDMAVEZDRGZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|