C14H12O4 — CID 764192
4-Oxo-1,2,3,4-tetrahydrocyclopenta[c]chromen-7-yl acetate (PubChem CID 764192) has the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. Its IUPAC name is (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) acetate.
| Compound Name | 4-Oxo-1,2,3,4-tetrahydrocyclopenta[c]chromen-7-yl acetate |
|---|---|
| PubChem CID | 764192 |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) acetate |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C3=C(CCC3)C(=O)O2 |
| InChI | InChI=1S/C14H12O4/c1-8(15)17-9-5-6-11-10-3-2-4-12(10)14(16)18-13(11)7-9/h5-7H,2-4H2,1H3 |
| InChIKey | IMGBRUFRLUUMEW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | 424 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|