C21H14Cl2O4 — CID 19177693
(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) (E)-3-(2,6-dichlorophenyl)prop-2-enoate (PubChem CID 19177693) has the molecular formula C21H14Cl2O4 and a molecular weight of 401.25 g/mol. Its IUPAC name is (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) (E)-3-(2,6-dichlorophenyl)prop-2-enoate.
| Compound Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) (E)-3-(2,6-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19177693 |
| Molecular Formula | C21H14Cl2O4 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) (E)-3-(2,6-dichlorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1c(Cl)cccc1Cl)Oc1ccc2c3c(c(=O)oc2c1)CCC3 |
| InChI | InChI=1S/C21H14Cl2O4/c22-17-5-2-6-18(23)16(17)9-10-20(24)26-12-7-8-14-13-3-1-4-15(13)21(25)27-19(14)11-12/h2,5-11H,1,3-4H2/b10-9+ |
| InChIKey | OHKZYDIFSQZNIX-MDZDMXLPSA-N |
| XLogP | 5.21 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|