C26H20ClNO6S — CID 2426918
(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 3-[(3-chlorophenyl)-methylsulfamoyl]benzoate (PubChem CID 2426918) has the molecular formula C26H20ClNO6S and a molecular weight of 509.97 g/mol. Its IUPAC name is (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 3-[(3-chlorophenyl)-methylsulfamoyl]benzoate.
| Compound Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 3-[(3-chlorophenyl)-methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 2426918 |
| Molecular Formula | C26H20ClNO6S |
| Molecular Weight | 509.97 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 3-[(3-chlorophenyl)-methylsulfamoyl]benzoate |
| SMILES | CN(c1cccc(Cl)c1)S(=O)(=O)c1cccc(C(=O)Oc2ccc3c4c(c(=O)oc3c2)CCC4)c1 |
| InChI | InChI=1S/C26H20ClNO6S/c1-28(18-7-3-6-17(27)14-18)35(31,32)20-8-2-5-16(13-20)25(29)33-19-11-12-22-21-9-4-10-23(21)26(30)34-24(22)15-19/h2-3,5-8,11-15H,4,9-10H2,1H3 |
| InChIKey | CSGQPXRSPNNACL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.97 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|