C21H18O6S — CID 16562997
(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 3-(methylsulfonylmethyl)benzoate (PubChem CID 16562997) has the molecular formula C21H18O6S and a molecular weight of 398.44 g/mol. Its IUPAC name is (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 3-(methylsulfonylmethyl)benzoate.
| Compound Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 3-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 16562997 |
| Molecular Formula | C21H18O6S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 3-(methylsulfonylmethyl)benzoate |
| SMILES | CS(=O)(=O)Cc1cccc(C(=O)Oc2ccc3c4c(c(=O)oc3c2)CCC4)c1 |
| InChI | InChI=1S/C21H18O6S/c1-28(24,25)12-13-4-2-5-14(10-13)20(22)26-15-8-9-17-16-6-3-7-18(16)21(23)27-19(17)11-15/h2,4-5,8-11H,3,6-7,12H2,1H3 |
| InChIKey | CBEYXJPVBLWLML-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 90.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|