C24H23NO6S — CID 4874980
(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-ethylsulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxylate (PubChem CID 4874980) has the molecular formula C24H23NO6S and a molecular weight of 453.52 g/mol. Its IUPAC name is (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-ethylsulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxylate.
| Compound Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-ethylsulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 4874980 |
| Molecular Formula | C24H23NO6S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-ethylsulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxylate |
| SMILES | CCS(=O)(=O)N1Cc2ccccc2CC1C(=O)Oc1ccc2c3c(c(=O)oc2c1)CCC3 |
| InChI | InChI=1S/C24H23NO6S/c1-2-32(28,29)25-14-16-7-4-3-6-15(16)12-21(25)24(27)30-17-10-11-19-18-8-5-9-20(18)23(26)31-22(19)13-17/h3-4,6-7,10-11,13,21H,2,5,8-9,12,14H2,1H3 |
| InChIKey | ZTRRSWHPCBSSJF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|