C22H14O6 — CID 19170323
(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-oxochromene-3-carboxylate (PubChem CID 19170323) has the molecular formula C22H14O6 and a molecular weight of 374.35 g/mol. Its IUPAC name is (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-oxochromene-3-carboxylate.
| Compound Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 19170323 |
| Molecular Formula | C22H14O6 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-oxochromene-3-carboxylate |
| SMILES | O=C(Oc1ccc2c3c(c(=O)oc2c1)CCC3)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C22H14O6/c23-20-16-6-3-5-14(16)15-9-8-13(11-19(15)28-20)26-21(24)17-10-12-4-1-2-7-18(12)27-22(17)25/h1-2,4,7-11H,3,5-6H2 |
| InChIKey | LRGSTUUCUHBKMV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 86.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|