C20H16O5 — CID 20990096
2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxymethyl]benzoic acid (PubChem CID 20990096) has the molecular formula C20H16O5 and a molecular weight of 336.34 g/mol. Its IUPAC name is 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxymethyl]benzoic acid.
| Compound Name | 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 20990096 |
| Molecular Formula | C20H16O5 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxymethyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1COc1ccc2c3c(c(=O)oc2c1)CCC3 |
| InChI | InChI=1S/C20H16O5/c21-19(22)14-5-2-1-4-12(14)11-24-13-8-9-16-15-6-3-7-17(15)20(23)25-18(16)10-13/h1-2,4-5,8-10H,3,6-7,11H2,(H,21,22) |
| InChIKey | RXUPDPFFSOSAQZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|