C21H18O5 — CID 20987124
2-[(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxymethyl]benzoic acid (PubChem CID 20987124) has the molecular formula C21H18O5 and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-[(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxymethyl]benzoic acid.
| Compound Name | 2-[(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 20987124 |
| Molecular Formula | C21H18O5 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-[(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxymethyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1COc1ccc2c3c(c(=O)oc2c1)CCCC3 |
| InChI | InChI=1S/C21H18O5/c22-20(23)15-6-2-1-5-13(15)12-25-14-9-10-17-16-7-3-4-8-18(16)21(24)26-19(17)11-14/h1-2,5-6,9-11H,3-4,7-8,12H2,(H,22,23) |
| InChIKey | QUIVIVGOVGMKPB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|