C20H17O6- — CID 7078069
5-methyl-4-[(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxymethyl]furan-2-carboxylate (PubChem CID 7078069) has the molecular formula C20H17O6- and a molecular weight of 353.35 g/mol. Its IUPAC name is 5-methyl-4-[(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxymethyl]furan-2-carboxylate.
| Compound Name | 5-methyl-4-[(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxymethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 7078069 |
| Molecular Formula | C20H17O6- |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 5-methyl-4-[(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxymethyl]furan-2-carboxylate |
| SMILES | Cc1oc(C(=O)[O-])cc1COc1ccc2c3c(c(=O)oc2c1)CCCC3 |
| InChI | InChI=1S/C20H18O6/c1-11-12(8-18(25-11)19(21)22)10-24-13-6-7-15-14-4-2-3-5-16(14)20(23)26-17(15)9-13/h6-9H,2-5,10H2,1H3,(H,21,22)/p-1 |
| InChIKey | MYLCYXOJPQFBAU-UHFFFAOYSA-M |
| XLogP | 2.52 |
| TPSA | 92.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|