C17H18O5 — CID 20991440
4-[(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxy]butanoic acid (PubChem CID 20991440) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is 4-[(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxy]butanoic acid.
| Compound Name | 4-[(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxy]butanoic acid |
|---|---|
| PubChem CID | 20991440 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 4-[(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxy]butanoic acid |
| SMILES | O=C(O)CCCOc1ccc2c3c(c(=O)oc2c1)CCCC3 |
| InChI | InChI=1S/C17H18O5/c18-16(19)6-3-9-21-11-7-8-13-12-4-1-2-5-14(12)17(20)22-15(13)10-11/h7-8,10H,1-6,9H2,(H,18,19) |
| InChIKey | WSPTUBBGYCCLBX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|