C24H18O5 — CID 7926793
naphthalen-2-yl 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetate (PubChem CID 7926793) has the molecular formula C24H18O5 and a molecular weight of 386.40 g/mol. Its IUPAC name is naphthalen-2-yl 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetate.
| Compound Name | naphthalen-2-yl 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetate |
|---|---|
| PubChem CID | 7926793 |
| Molecular Formula | C24H18O5 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | naphthalen-2-yl 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetate |
| SMILES | O=C(COc1ccc2c3c(c(=O)oc2c1)CCC3)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H18O5/c25-23(28-18-9-8-15-4-1-2-5-16(15)12-18)14-27-17-10-11-20-19-6-3-7-21(19)24(26)29-22(20)13-17/h1-2,4-5,8-13H,3,6-7,14H2 |
| InChIKey | RVLAJOCZAHNIME-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|