C26H20O6 — CID 2649504
(2-naphthalen-2-yl-2-oxoethyl) 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetate (PubChem CID 2649504) has the molecular formula C26H20O6 and a molecular weight of 428.44 g/mol. Its IUPAC name is (2-naphthalen-2-yl-2-oxoethyl) 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetate.
| Compound Name | (2-naphthalen-2-yl-2-oxoethyl) 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetate |
|---|---|
| PubChem CID | 2649504 |
| Molecular Formula | C26H20O6 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (2-naphthalen-2-yl-2-oxoethyl) 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetate |
| SMILES | O=C(COc1ccc2c3c(c(=O)oc2c1)CCC3)OCC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H20O6/c27-23(18-9-8-16-4-1-2-5-17(16)12-18)14-31-25(28)15-30-19-10-11-21-20-6-3-7-22(20)26(29)32-24(21)13-19/h1-2,4-5,8-13H,3,6-7,14-15H2 |
| InChIKey | WEWFLZQSDLMYEO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|