C22H20O5 — CID 2290973
3-[2-(3-methoxyphenyl)-2-oxoethoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one (PubChem CID 2290973) has the molecular formula C22H20O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is 3-[2-(3-methoxyphenyl)-2-oxoethoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one.
| Compound Name | 3-[2-(3-methoxyphenyl)-2-oxoethoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 2290973 |
| Molecular Formula | C22H20O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 3-[2-(3-methoxyphenyl)-2-oxoethoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
| SMILES | COc1cccc(C(=O)COc2ccc3c4c(c(=O)oc3c2)CCCC4)c1 |
| InChI | InChI=1S/C22H20O5/c1-25-15-6-4-5-14(11-15)20(23)13-26-16-9-10-18-17-7-2-3-8-19(17)22(24)27-21(18)12-16/h4-6,9-12H,2-3,7-8,13H2,1H3 |
| InChIKey | AGMKMCUWPHKOKE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|