C24H24O5 — CID 1299986
3-[2-(3-methoxyphenyl)-2-oxoethoxy]-4-methyl-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-6-one (PubChem CID 1299986) has the molecular formula C24H24O5 and a molecular weight of 392.45 g/mol. Its IUPAC name is 3-[2-(3-methoxyphenyl)-2-oxoethoxy]-4-methyl-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-6-one.
| Compound Name | 3-[2-(3-methoxyphenyl)-2-oxoethoxy]-4-methyl-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-6-one |
|---|---|
| PubChem CID | 1299986 |
| Molecular Formula | C24H24O5 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 3-[2-(3-methoxyphenyl)-2-oxoethoxy]-4-methyl-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-6-one |
| SMILES | COc1cccc(C(=O)COc2ccc3c4c(c(=O)oc3c2C)CCCCC4)c1 |
| InChI | InChI=1S/C24H24O5/c1-15-22(28-14-21(25)16-7-6-8-17(13-16)27-2)12-11-19-18-9-4-3-5-10-20(18)24(26)29-23(15)19/h6-8,11-13H,3-5,9-10,14H2,1-2H3 |
| InChIKey | SSWLETGZKJNHQP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|