C20H18O5 — CID 906880
(3,4,8-trimethyl-2-oxochromen-7-yl) 3-methoxybenzoate (PubChem CID 906880) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is (3,4,8-trimethyl-2-oxochromen-7-yl) 3-methoxybenzoate.
| Compound Name | (3,4,8-trimethyl-2-oxochromen-7-yl) 3-methoxybenzoate |
|---|---|
| PubChem CID | 906880 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (3,4,8-trimethyl-2-oxochromen-7-yl) 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc3c(C)c(C)c(=O)oc3c2C)c1 |
| InChI | InChI=1S/C20H18O5/c1-11-12(2)19(21)25-18-13(3)17(9-8-16(11)18)24-20(22)14-6-5-7-15(10-14)23-4/h5-10H,1-4H3 |
| InChIKey | LNZJMUHNARCMOS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|