C19H13NO4 — CID 7917008
(4,8-dimethyl-2-oxochromen-7-yl) 3-cyanobenzoate (PubChem CID 7917008) has the molecular formula C19H13NO4 and a molecular weight of 319.32 g/mol. Its IUPAC name is (4,8-dimethyl-2-oxochromen-7-yl) 3-cyanobenzoate.
| Compound Name | (4,8-dimethyl-2-oxochromen-7-yl) 3-cyanobenzoate |
|---|---|
| PubChem CID | 7917008 |
| Molecular Formula | C19H13NO4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | (4,8-dimethyl-2-oxochromen-7-yl) 3-cyanobenzoate |
| SMILES | Cc1cc(=O)oc2c(C)c(OC(=O)c3cccc(C#N)c3)ccc12 |
| InChI | InChI=1S/C19H13NO4/c1-11-8-17(21)24-18-12(2)16(7-6-15(11)18)23-19(22)14-5-3-4-13(9-14)10-20/h3-9H,1-2H3 |
| InChIKey | AQBORHNSHKYBOC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 80.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|