C18H13NO6 — CID 7917022
(4,8-dimethyl-2-oxochromen-7-yl) 4-nitrobenzoate (PubChem CID 7917022) has the molecular formula C18H13NO6 and a molecular weight of 339.30 g/mol. Its IUPAC name is (4,8-dimethyl-2-oxochromen-7-yl) 4-nitrobenzoate.
| Compound Name | (4,8-dimethyl-2-oxochromen-7-yl) 4-nitrobenzoate |
|---|---|
| PubChem CID | 7917022 |
| Molecular Formula | C18H13NO6 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | (4,8-dimethyl-2-oxochromen-7-yl) 4-nitrobenzoate |
| SMILES | Cc1cc(=O)oc2c(C)c(OC(=O)c3ccc([N+](=O)[O-])cc3)ccc12 |
| InChI | InChI=1S/C18H13NO6/c1-10-9-16(20)25-17-11(2)15(8-7-14(10)17)24-18(21)12-3-5-13(6-4-12)19(22)23/h3-9H,1-2H3 |
| InChIKey | WUQIWGNLVRXDMP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 99.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|