C60H30N6O24 — CID 100977901
[3,6,7,10,11-pentakis[(4-nitrobenzoyl)oxy]triphenylen-2-yl] 4-nitrobenzoate (PubChem CID 100977901) has the molecular formula C60H30N6O24 and a molecular weight of 1218.92 g/mol. Its IUPAC name is [3,6,7,10,11-pentakis[(4-nitrobenzoyl)oxy]triphenylen-2-yl] 4-nitrobenzoate.
| Compound Name | [3,6,7,10,11-pentakis[(4-nitrobenzoyl)oxy]triphenylen-2-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 100977901 |
| Molecular Formula | C60H30N6O24 |
| Molecular Weight | 1218.92 g/mol |
| Exact Mass | 1218.13 |
| IUPAC Name | [3,6,7,10,11-pentakis[(4-nitrobenzoyl)oxy]triphenylen-2-yl] 4-nitrobenzoate |
| SMILES | O=C(Oc1cc2c3cc(OC(=O)c4ccc([N+](=O)[O-])cc4)c(OC(=O)c4ccc([N+](=O)[O-])cc4)cc3c3cc(OC(=O)c4ccc([N+](=O)[O-])cc4)c(OC(=O)c4ccc([N+](=O)[O-])cc4)cc3c2cc1OC(=O)c1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C60H30N6O24/c67-55(31-1-13-37(14-2-31)61(73)74)85-49-25-43-44(26-50(49)86-56(68)32-3-15-38(16-4-32)62(75)76)46-28-52(88-58(70)34-7-19-40(20-8-34)64(79)80)54(90-60(72)36-11-23-42(24-12-36)66(83)84)30-48(46)47-29-53(89-59(71)35-9-21-41(22-10-35)65(81)82)51(27-45(43)47)87-57(69)33-5-17-39(18-6-33)63(77)78/h1-30H |
| InChIKey | OZTSNMVWHSLPDS-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 416.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 90 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1218.92 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|