C16H13NO7 — CID 804644
(4-formyl-2,6-dimethoxyphenyl) 4-nitrobenzoate (PubChem CID 804644) has the molecular formula C16H13NO7 and a molecular weight of 331.28 g/mol. Its IUPAC name is (4-formyl-2,6-dimethoxyphenyl) 4-nitrobenzoate.
| Compound Name | (4-formyl-2,6-dimethoxyphenyl) 4-nitrobenzoate |
|---|---|
| PubChem CID | 804644 |
| Molecular Formula | C16H13NO7 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | (4-formyl-2,6-dimethoxyphenyl) 4-nitrobenzoate |
| SMILES | COc1cc(C=O)cc(OC)c1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H13NO7/c1-22-13-7-10(9-18)8-14(23-2)15(13)24-16(19)11-3-5-12(6-4-11)17(20)21/h3-9H,1-2H3 |
| InChIKey | UJDLGMJRXWPCSJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|