C14H7Cl2NO5 — CID 4924587
(2,4-dichloro-6-formylphenyl) 4-nitrobenzoate (PubChem CID 4924587) has the molecular formula C14H7Cl2NO5 and a molecular weight of 340.12 g/mol. Its IUPAC name is (2,4-dichloro-6-formylphenyl) 4-nitrobenzoate.
| Compound Name | (2,4-dichloro-6-formylphenyl) 4-nitrobenzoate |
|---|---|
| PubChem CID | 4924587 |
| Molecular Formula | C14H7Cl2NO5 |
| Molecular Weight | 340.12 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | (2,4-dichloro-6-formylphenyl) 4-nitrobenzoate |
| SMILES | O=Cc1cc(Cl)cc(Cl)c1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H7Cl2NO5/c15-10-5-9(7-18)13(12(16)6-10)22-14(19)8-1-3-11(4-2-8)17(20)21/h1-7H |
| InChIKey | ZPGHKFWSALPZJF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.12 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|