C14H8Cl3NO6S — CID 55335083
(2,4,6-trichlorophenyl) 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 55335083) has the molecular formula C14H8Cl3NO6S and a molecular weight of 424.65 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | (2,4,6-trichlorophenyl) 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 55335083 |
| Molecular Formula | C14H8Cl3NO6S |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 422.91 |
| IUPAC Name | (2,4,6-trichlorophenyl) 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Oc2c(Cl)cc(Cl)cc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H8Cl3NO6S/c1-25(22,23)12-3-2-7(4-11(12)18(20)21)14(19)24-13-9(16)5-8(15)6-10(13)17/h2-6H,1H3 |
| InChIKey | ASAGHSBDFOOWHH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|