C13H15NO8S — CID 27026883
(2-oxo-2-propan-2-yloxyethyl) 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 27026883) has the molecular formula C13H15NO8S and a molecular weight of 345.33 g/mol. Its IUPAC name is (2-oxo-2-propan-2-yloxyethyl) 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | (2-oxo-2-propan-2-yloxyethyl) 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 27026883 |
| Molecular Formula | C13H15NO8S |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | (2-oxo-2-propan-2-yloxyethyl) 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | CC(C)OC(=O)COC(=O)c1ccc(S(C)(=O)=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H15NO8S/c1-8(2)22-12(15)7-21-13(16)9-4-5-11(23(3,19)20)10(6-9)14(17)18/h4-6,8H,7H2,1-3H3 |
| InChIKey | ONRNYISAGAKXDU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 129.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|