C18H25N3O7S — CID 44623864
[2-[4-(2-methylpropyl)piperazin-1-yl]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 44623864) has the molecular formula C18H25N3O7S and a molecular weight of 427.48 g/mol. Its IUPAC name is [2-[4-(2-methylpropyl)piperazin-1-yl]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | [2-[4-(2-methylpropyl)piperazin-1-yl]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 44623864 |
| Molecular Formula | C18H25N3O7S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | [2-[4-(2-methylpropyl)piperazin-1-yl]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | CC(C)CN1CCN(C(=O)COC(=O)c2ccc(S(C)(=O)=O)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C18H25N3O7S/c1-13(2)11-19-6-8-20(9-7-19)17(22)12-28-18(23)14-4-5-16(29(3,26)27)15(10-14)21(24)25/h4-5,10,13H,6-9,11-12H2,1-3H3 |
| InChIKey | UQEANGJNYLXOQG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|