C17H22N2O7S — CID 42103275
[(2S)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 42103275) has the molecular formula C17H22N2O7S and a molecular weight of 398.44 g/mol. Its IUPAC name is [(2S)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | [(2S)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 42103275 |
| Molecular Formula | C17H22N2O7S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | [(2S)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | CC1CCN(C(=O)[C@H](C)OC(=O)c2ccc(S(C)(=O)=O)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C17H22N2O7S/c1-11-6-8-18(9-7-11)16(20)12(2)26-17(21)13-4-5-15(27(3,24)25)14(10-13)19(22)23/h4-5,10-12H,6-9H2,1-3H3/t12-/m0/s1 |
| InChIKey | FEWIZARYAYSELW-LBPRGKRZSA-N |
| XLogP | 1.80 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|