C19H18N2O7S — CID 2661853
[(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 2661853) has the molecular formula C19H18N2O7S and a molecular weight of 418.43 g/mol. Its IUPAC name is [(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | [(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 2661853 |
| Molecular Formula | C19H18N2O7S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | [(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(S(C)(=O)=O)c([N+](=O)[O-])c1)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C19H18N2O7S/c1-12(18(22)20-10-9-13-5-3-4-6-15(13)20)28-19(23)14-7-8-17(29(2,26)27)16(11-14)21(24)25/h3-8,11-12H,9-10H2,1-2H3/t12-/m1/s1 |
| InChIKey | ANEKJDLSMZDSGT-GFCCVEGCSA-N |
| XLogP | 2.13 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|