C18H17ClN2O5S — CID 16537968
[1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 4-chloro-3-sulfamoylbenzoate (PubChem CID 16537968) has the molecular formula C18H17ClN2O5S and a molecular weight of 408.86 g/mol. Its IUPAC name is [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 4-chloro-3-sulfamoylbenzoate.
| Compound Name | [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 4-chloro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 16537968 |
| Molecular Formula | C18H17ClN2O5S |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 4-chloro-3-sulfamoylbenzoate |
| SMILES | CC(OC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C18H17ClN2O5S/c1-11(17(22)21-9-8-12-4-2-3-5-15(12)21)26-18(23)13-6-7-14(19)16(10-13)27(20,24)25/h2-7,10-11H,8-9H2,1H3,(H2,20,24,25) |
| InChIKey | WVYDQQHBXHRGQQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |