C18H15Cl2NO3 — CID 2661564
[(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2,5-dichlorobenzoate (PubChem CID 2661564) has the molecular formula C18H15Cl2NO3 and a molecular weight of 364.23 g/mol. Its IUPAC name is [(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2,5-dichlorobenzoate.
| Compound Name | [(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2,5-dichlorobenzoate |
|---|---|
| PubChem CID | 2661564 |
| Molecular Formula | C18H15Cl2NO3 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | [(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2,5-dichlorobenzoate |
| SMILES | C[C@H](OC(=O)c1cc(Cl)ccc1Cl)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C18H15Cl2NO3/c1-11(24-18(23)14-10-13(19)6-7-15(14)20)17(22)21-9-8-12-4-2-3-5-16(12)21/h2-7,10-11H,8-9H2,1H3/t11-/m0/s1 |
| InChIKey | VNDTWVXOJWSGMJ-NSHDSACASA-N |
| XLogP | 4.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |