C25H20ClNO4 — CID 16540390
[1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2-(4-chlorobenzoyl)benzoate (PubChem CID 16540390) has the molecular formula C25H20ClNO4 and a molecular weight of 433.89 g/mol. Its IUPAC name is [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2-(4-chlorobenzoyl)benzoate.
| Compound Name | [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2-(4-chlorobenzoyl)benzoate |
|---|---|
| PubChem CID | 16540390 |
| Molecular Formula | C25H20ClNO4 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2-(4-chlorobenzoyl)benzoate |
| SMILES | CC(OC(=O)c1ccccc1C(=O)c1ccc(Cl)cc1)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C25H20ClNO4/c1-16(24(29)27-15-14-17-6-2-5-9-22(17)27)31-25(30)21-8-4-3-7-20(21)23(28)18-10-12-19(26)13-11-18/h2-13,16H,14-15H2,1H3 |
| InChIKey | YLYUYKMPXBGMTI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |