C25H23NO3 — CID 7809519
[(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2-benzylbenzoate (PubChem CID 7809519) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is [(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2-benzylbenzoate.
| Compound Name | [(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2-benzylbenzoate |
|---|---|
| PubChem CID | 7809519 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | [(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2-benzylbenzoate |
| SMILES | C[C@@H](OC(=O)c1ccccc1Cc1ccccc1)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C25H23NO3/c1-18(24(27)26-16-15-20-11-6-8-14-23(20)26)29-25(28)22-13-7-5-12-21(22)17-19-9-3-2-4-10-19/h2-14,18H,15-17H2,1H3/t18-/m1/s1 |
| InChIKey | PNSQMQUXPCGHNZ-GOSISDBHSA-N |
| XLogP | 4.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |