C25H21NO4 — CID 2661465
[(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2-benzoylbenzoate (PubChem CID 2661465) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is [(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2-benzoylbenzoate.
| Compound Name | [(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2-benzoylbenzoate |
|---|---|
| PubChem CID | 2661465 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | [(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2-benzoylbenzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1C(=O)c1ccccc1)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C25H21NO4/c1-17(24(28)26-16-15-18-9-5-8-14-22(18)26)30-25(29)21-13-7-6-12-20(21)23(27)19-10-3-2-4-11-19/h2-14,17H,15-16H2,1H3/t17-/m0/s1 |
| InChIKey | DUHPTIHIFATAHH-KRWDZBQOSA-N |
| XLogP | 4.05 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |