C18H15F2NO3 — CID 4876669
[1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2,4-difluorobenzoate (PubChem CID 4876669) has the molecular formula C18H15F2NO3 and a molecular weight of 331.32 g/mol. Its IUPAC name is [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2,4-difluorobenzoate.
| Compound Name | [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2,4-difluorobenzoate |
|---|---|
| PubChem CID | 4876669 |
| Molecular Formula | C18H15F2NO3 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2,4-difluorobenzoate |
| SMILES | CC(OC(=O)c1ccc(F)cc1F)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C18H15F2NO3/c1-11(24-18(23)14-7-6-13(19)10-15(14)20)17(22)21-9-8-12-4-2-3-5-16(12)21/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | UKVMMVGCDDOEGV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |