C18H16FNO3 — CID 2661473
[(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 4-fluorobenzoate (PubChem CID 2661473) has the molecular formula C18H16FNO3 and a molecular weight of 313.33 g/mol. Its IUPAC name is [(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 4-fluorobenzoate.
| Compound Name | [(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 2661473 |
| Molecular Formula | C18H16FNO3 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | [(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 4-fluorobenzoate |
| SMILES | C[C@H](OC(=O)c1ccc(F)cc1)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C18H16FNO3/c1-12(23-18(22)14-6-8-15(19)9-7-14)17(21)20-11-10-13-4-2-3-5-16(13)20/h2-9,12H,10-11H2,1H3/t12-/m0/s1 |
| InChIKey | SHTRQMWSXNSKPU-LBPRGKRZSA-N |
| XLogP | 2.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |