C22H20N2O5 — CID 42898545
[1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 42898545) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 42898545 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | CC(OC(=O)c1ccc(N2C(=O)CCC2=O)cc1)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C22H20N2O5/c1-14(21(27)23-13-12-15-4-2-3-5-18(15)23)29-22(28)16-6-8-17(9-7-16)24-19(25)10-11-20(24)26/h2-9,14H,10-13H2,1H3 |
| InChIKey | BLWKTOWEFLTXIS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|