C26H21NO3 — CID 7786581
[(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] anthracene-9-carboxylate (PubChem CID 7786581) has the molecular formula C26H21NO3 and a molecular weight of 395.46 g/mol. Its IUPAC name is [(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] anthracene-9-carboxylate.
| Compound Name | [(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 7786581 |
| Molecular Formula | C26H21NO3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | [(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] anthracene-9-carboxylate |
| SMILES | C[C@H](OC(=O)c1c2ccccc2cc2ccccc12)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C26H21NO3/c1-17(25(28)27-15-14-18-8-4-7-13-23(18)27)30-26(29)24-21-11-5-2-9-19(21)16-20-10-3-6-12-22(20)24/h2-13,16-17H,14-15H2,1H3/t17-/m0/s1 |
| InChIKey | WHIDJIBAJIZPNC-KRWDZBQOSA-N |
| XLogP | 5.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|