C27H23NO3 — CID 7786546
[(2R)-1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-1-oxopropan-2-yl] anthracene-9-carboxylate (PubChem CID 7786546) has the molecular formula C27H23NO3 and a molecular weight of 409.49 g/mol. Its IUPAC name is [(2R)-1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-1-oxopropan-2-yl] anthracene-9-carboxylate.
| Compound Name | [(2R)-1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-1-oxopropan-2-yl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 7786546 |
| Molecular Formula | C27H23NO3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | [(2R)-1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-1-oxopropan-2-yl] anthracene-9-carboxylate |
| SMILES | C[C@@H](OC(=O)c1c2ccccc2cc2ccccc12)C(=O)N1c2ccccc2C[C@@H]1C |
| InChI | InChI=1S/C27H23NO3/c1-17-15-21-11-5-8-14-24(21)28(17)26(29)18(2)31-27(30)25-22-12-6-3-9-19(22)16-20-10-4-7-13-23(20)25/h3-14,16-18H,15H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | AGDNOEGERJVBLU-ZWKOTPCHSA-N |
| XLogP | 5.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|