C18H16Cl2N2O3 — CID 7864788
[(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2-amino-3,5-dichlorobenzoate (PubChem CID 7864788) has the molecular formula C18H16Cl2N2O3 and a molecular weight of 379.24 g/mol. Its IUPAC name is [(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2-amino-3,5-dichlorobenzoate.
| Compound Name | [(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2-amino-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 7864788 |
| Molecular Formula | C18H16Cl2N2O3 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | [(2S)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 2-amino-3,5-dichlorobenzoate |
| SMILES | C[C@H](OC(=O)c1cc(Cl)cc(Cl)c1N)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C18H16Cl2N2O3/c1-10(17(23)22-7-6-11-4-2-3-5-15(11)22)25-18(24)13-8-12(19)9-14(20)16(13)21/h2-5,8-10H,6-7,21H2,1H3/t10-/m0/s1 |
| InChIKey | PIBXJJPVNRACNY-JTQLQIEISA-N |
| XLogP | 3.71 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|