C18H18N2O7S2 — CID 55523853
[1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-1-oxopropan-2-yl] 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 55523853) has the molecular formula C18H18N2O7S2 and a molecular weight of 438.48 g/mol. Its IUPAC name is [1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-1-oxopropan-2-yl] 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | [1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-1-oxopropan-2-yl] 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 55523853 |
| Molecular Formula | C18H18N2O7S2 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | [1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-1-oxopropan-2-yl] 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | CC(OC(=O)c1ccc(S(C)(=O)=O)c([N+](=O)[O-])c1)C(=O)N1CCc2sccc2C1 |
| InChI | InChI=1S/C18H18N2O7S2/c1-11(17(21)19-7-5-15-13(10-19)6-8-28-15)27-18(22)12-3-4-16(29(2,25)26)14(9-12)20(23)24/h3-4,6,8-9,11H,5,7,10H2,1-2H3 |
| InChIKey | XOJRCWIIEIWAEI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|