C21H22N2O6 — CID 9388808
[(2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 4-ethoxy-3-nitrobenzoate (PubChem CID 9388808) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is [(2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 4-ethoxy-3-nitrobenzoate.
| Compound Name | [(2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 4-ethoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 9388808 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | [(2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 4-ethoxy-3-nitrobenzoate |
| SMILES | CCOc1ccc(C(=O)O[C@H](C)C(=O)N2CCc3ccccc3C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H22N2O6/c1-3-28-19-9-8-16(12-18(19)23(26)27)21(25)29-14(2)20(24)22-11-10-15-6-4-5-7-17(15)13-22/h4-9,12,14H,3,10-11,13H2,1-2H3/t14-/m1/s1 |
| InChIKey | FUFOYNPRWWVUJC-CQSZACIVSA-N |
| XLogP | 3.12 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|