C23H21N3O5S2 — CID 46795536
[1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 46795536) has the molecular formula C23H21N3O5S2 and a molecular weight of 483.57 g/mol. Its IUPAC name is [1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | [1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 46795536 |
| Molecular Formula | C23H21N3O5S2 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | [1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | Cc1csc(Sc2ccc(C(=O)OC(C)C(=O)N3CCc4ccccc4C3)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C23H21N3O5S2/c1-14-13-32-23(24-14)33-20-8-7-17(11-19(20)26(29)30)22(28)31-15(2)21(27)25-10-9-16-5-3-4-6-18(16)12-25/h3-8,11,13,15H,9-10,12H2,1-2H3 |
| InChIKey | WSWJAKVBZSVEEY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|