C22H21N3O5S2 — CID 46623027
[1-(2,4-dimethylanilino)-1-oxopropan-2-yl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 46623027) has the molecular formula C22H21N3O5S2 and a molecular weight of 471.56 g/mol. Its IUPAC name is [1-(2,4-dimethylanilino)-1-oxopropan-2-yl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | [1-(2,4-dimethylanilino)-1-oxopropan-2-yl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 46623027 |
| Molecular Formula | C22H21N3O5S2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | [1-(2,4-dimethylanilino)-1-oxopropan-2-yl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | Cc1ccc(NC(=O)C(C)OC(=O)c2ccc(Sc3nc(C)cs3)c([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C22H21N3O5S2/c1-12-5-7-17(13(2)9-12)24-20(26)15(4)30-21(27)16-6-8-19(18(10-16)25(28)29)32-22-23-14(3)11-31-22/h5-11,15H,1-4H3,(H,24,26) |
| InChIKey | JBPMKLMGUSHKPK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|