C19H12F2N2O5S2 — CID 46795591
[2-(3,4-difluorophenyl)-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 46795591) has the molecular formula C19H12F2N2O5S2 and a molecular weight of 450.44 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 46795591 |
| Molecular Formula | C19H12F2N2O5S2 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | Cc1csc(Sc2ccc(C(=O)OCC(=O)c3ccc(F)c(F)c3)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C19H12F2N2O5S2/c1-10-9-29-19(22-10)30-17-5-3-12(7-15(17)23(26)27)18(25)28-8-16(24)11-2-4-13(20)14(21)6-11/h2-7,9H,8H2,1H3 |
| InChIKey | AGORQJMGZZLWGP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 99.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|