C22H21N3O7S2 — CID 2418000
ethyl 2,5-dimethyl-4-[2-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoyl]oxyacetyl]-1H-pyrrole-3-carboxylate (PubChem CID 2418000) has the molecular formula C22H21N3O7S2 and a molecular weight of 503.56 g/mol. Its IUPAC name is ethyl 2,5-dimethyl-4-[2-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoyl]oxyacetyl]-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2,5-dimethyl-4-[2-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoyl]oxyacetyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 2418000 |
| Molecular Formula | C22H21N3O7S2 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.08 |
| IUPAC Name | ethyl 2,5-dimethyl-4-[2-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoyl]oxyacetyl]-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C)c1C(=O)COC(=O)c1ccc(Sc2nc(C)cs2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H21N3O7S2/c1-5-31-21(28)19-13(4)24-12(3)18(19)16(26)9-32-20(27)14-6-7-17(15(8-14)25(29)30)34-22-23-11(2)10-33-22/h6-8,10,24H,5,9H2,1-4H3 |
| InChIKey | KKGCNTUNGUPPAS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 141.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|