C12H12N4O4S — CID 56772771
ethyl 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 56772771) has the molecular formula C12H12N4O4S and a molecular weight of 308.32 g/mol. Its IUPAC name is ethyl 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | ethyl 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 56772771 |
| Molecular Formula | C12H12N4O4S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | ethyl 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | CCOC(=O)c1ccc(Sc2n[nH]c(C)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H12N4O4S/c1-3-20-11(17)8-4-5-10(9(6-8)16(18)19)21-12-13-7(2)14-15-12/h4-6H,3H2,1-2H3,(H,13,14,15) |
| InChIKey | GQUKEDWLFNEHSK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|