About ethyl 4-ethyl-3-nitrobenzoate
ethyl 4-ethyl-3-nitrobenzoate (PubChem CID 43448997) has the molecular formula C11H13NO4
and a molecular weight of 223.23 g/mol. Its IUPAC name is ethyl 4-ethyl-3-nitrobenzoate.
Molecular Properties
| Compound Name | ethyl 4-ethyl-3-nitrobenzoate |
| PubChem CID | 43448997 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | ethyl 4-ethyl-3-nitrobenzoate |
| SMILES | CCOC(=O)c1ccc(CC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H13NO4/c1-3-8-5-6-9(11(13)16-4-2)7-10(8)12(14)15/h5-7H,3-4H2,1-2H3 |
| InChIKey | FSESIRYZCVBSIP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-ethyl-3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-ethyl-3-nitrobenzoate?
The IUPAC name of ethyl 4-ethyl-3-nitrobenzoate (CID 43448997) is ethyl 4-ethyl-3-nitrobenzoate.
What is the SMILES notation for ethyl 4-ethyl-3-nitrobenzoate?
The canonical SMILES for ethyl 4-ethyl-3-nitrobenzoate is CCOC(=O)c1ccc(CC)c([N+](=O)[O-])c1.
What is the InChIKey of ethyl 4-ethyl-3-nitrobenzoate?
The InChIKey is FSESIRYZCVBSIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO4/c1-3-8-5-6-9(11(13)16-4-2)7-10(8)12(14)15/h5-7H,3-4H2,1-2H3.
What are the key properties of ethyl 4-ethyl-3-nitrobenzoate?
ethyl 4-ethyl-3-nitrobenzoate has a molecular weight of 223.23 g/mol, XLogP of 2.33, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-ethyl-3-nitrobenzoate is sourced from PubChem (CID 43448997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).