C24H21ClN2O5 — CID 67551448
ethyl 4-[2-[[4-(4-chlorophenyl)benzoyl]amino]ethyl]-3-nitrobenzoate (PubChem CID 67551448) has the molecular formula C24H21ClN2O5 and a molecular weight of 452.89 g/mol. Its IUPAC name is ethyl 4-[2-[[4-(4-chlorophenyl)benzoyl]amino]ethyl]-3-nitrobenzoate.
| Compound Name | ethyl 4-[2-[[4-(4-chlorophenyl)benzoyl]amino]ethyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 67551448 |
| Molecular Formula | C24H21ClN2O5 |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | ethyl 4-[2-[[4-(4-chlorophenyl)benzoyl]amino]ethyl]-3-nitrobenzoate |
| SMILES | CCOC(=O)c1ccc(CCNC(=O)c2ccc(-c3ccc(Cl)cc3)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H21ClN2O5/c1-2-32-24(29)20-8-5-18(22(15-20)27(30)31)13-14-26-23(28)19-6-3-16(4-7-19)17-9-11-21(25)12-10-17/h3-12,15H,2,13-14H2,1H3,(H,26,28) |
| InChIKey | RLZUUMADDRUSCZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|